C16H22FN3O — CID 91402062
1,3-dicyclopropyl-5-(3-fluoro-4-methoxyphenyl)-1,3,5-triazinane (PubChem CID 91402062) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is 1,3-dicyclopropyl-5-(3-fluoro-4-methoxyphenyl)-1,3,5-triazinane.
| Compound Name | 1,3-dicyclopropyl-5-(3-fluoro-4-methoxyphenyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 91402062 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1,3-dicyclopropyl-5-(3-fluoro-4-methoxyphenyl)-1,3,5-triazinane |
| SMILES | COc1ccc(N2CN(C3CC3)CN(C3CC3)C2)cc1F |
| InChI | InChI=1S/C16H22FN3O/c1-21-16-7-6-14(8-15(16)17)20-10-18(12-2-3-12)9-19(11-20)13-4-5-13/h6-8,12-13H,2-5,9-11H2,1H3 |
| InChIKey | VOSZSWLEUMRQQT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|