C17H19F6NO4 — CID 91402343
[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino] 2-ethyloxane-4-carboxylate (PubChem CID 91402343) has the molecular formula C17H19F6NO4 and a molecular weight of 415.33 g/mol. Its IUPAC name is [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino] 2-ethyloxane-4-carboxylate.
| Compound Name | [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino] 2-ethyloxane-4-carboxylate |
|---|---|
| PubChem CID | 91402343 |
| Molecular Formula | C17H19F6NO4 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino] 2-ethyloxane-4-carboxylate |
| SMILES | CCC1CC(C(=O)ONc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)CCO1 |
| InChI | InChI=1S/C17H19F6NO4/c1-2-13-9-10(7-8-27-13)14(25)28-24-12-5-3-11(4-6-12)15(26,16(18,19)20)17(21,22)23/h3-6,10,13,24,26H,2,7-9H2,1H3 |
| InChIKey | XVBFXJJEBVODDI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|