C8H20N2O3 — CID 91402432
(2S,4S)-2,3,4-trimethoxypentane-1,5-diamine (PubChem CID 91402432) has the molecular formula C8H20N2O3 and a molecular weight of 192.26 g/mol. Its IUPAC name is (2S,4S)-2,3,4-trimethoxypentane-1,5-diamine.
| Compound Name | (2S,4S)-2,3,4-trimethoxypentane-1,5-diamine |
|---|---|
| PubChem CID | 91402432 |
| Molecular Formula | C8H20N2O3 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (2S,4S)-2,3,4-trimethoxypentane-1,5-diamine |
| SMILES | COC([C@H](CN)OC)[C@H](CN)OC |
| InChI | InChI=1S/C8H20N2O3/c1-11-6(4-9)8(13-3)7(5-10)12-2/h6-8H,4-5,9-10H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | OJNLJSXXNBMQPG-BQBZGAKWSA-N |
| XLogP | -1.05 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |