C20H25NO3 — CID 91403199
3-(5-aminooxy-2-cyclopropylphenyl)-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione (PubChem CID 91403199) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 3-(5-aminooxy-2-cyclopropylphenyl)-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(5-aminooxy-2-cyclopropylphenyl)-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91403199 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 3-(5-aminooxy-2-cyclopropylphenyl)-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC12CCC(C(=O)C(c3cc(ON)ccc3C3CC3)C1=O)C2(C)C |
| InChI | InChI=1S/C20H25NO3/c1-19(2)15-8-9-20(19,3)18(23)16(17(15)22)14-10-12(24-21)6-7-13(14)11-4-5-11/h6-7,10-11,15-16H,4-5,8-9,21H2,1-3H3 |
| InChIKey | LSTWTGBQRSAXEI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|