C22H26BrFN2O4 — CID 91403362
methyl 3-[(1R,2R,3R,4S)-3-[(4-bromo-2-fluorophenyl)methyl]-2,3-dicarbamoylspiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2-yl]propanoate (PubChem CID 91403362) has the molecular formula C22H26BrFN2O4 and a molecular weight of 481.36 g/mol. Its IUPAC name is methyl 3-[(1R,2R,3R,4S)-3-[(4-bromo-2-fluorophenyl)methyl]-2,3-dicarbamoylspiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2-yl]propanoate.
| Compound Name | methyl 3-[(1R,2R,3R,4S)-3-[(4-bromo-2-fluorophenyl)methyl]-2,3-dicarbamoylspiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2-yl]propanoate |
|---|---|
| PubChem CID | 91403362 |
| Molecular Formula | C22H26BrFN2O4 |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | methyl 3-[(1R,2R,3R,4S)-3-[(4-bromo-2-fluorophenyl)methyl]-2,3-dicarbamoylspiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2-yl]propanoate |
| SMILES | COC(=O)CC[C@@]1(C(N)=O)[C@@H]2CC[C@@H](C23CC3)[C@@]1(Cc1ccc(Br)cc1F)C(N)=O |
| InChI | InChI=1S/C22H26BrFN2O4/c1-30-17(27)6-7-21(18(25)28)15-4-5-16(20(15)8-9-20)22(21,19(26)29)11-12-2-3-13(23)10-14(12)24/h2-3,10,15-16H,4-9,11H2,1H3,(H2,25,28)(H2,26,29)/t15-,16+,21+,22+/m1/s1 |
| InChIKey | IXYYDNBWHQYKII-AERDPVEMSA-N |
| XLogP | 2.85 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |