C28H35Cl2FN2O3 — CID 91403515
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-5-(cyclohexylmethyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide (PubChem CID 91403515) has the molecular formula C28H35Cl2FN2O3 and a molecular weight of 537.50 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-5-(cyclohexylmethyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-5-(cyclohexylmethyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91403515 |
| Molecular Formula | C28H35Cl2FN2O3 |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-5-(cyclohexylmethyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC[C@H](O)CO)[C@@H]1N[C@@H](CC2CCCCC2)[C@@H](c2ccc(Cl)cc2)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C28H35Cl2FN2O3/c29-19-11-9-18(10-12-19)24-23(15-17-5-2-1-3-6-17)33-27(28(36)32-14-13-20(35)16-34)25(24)21-7-4-8-22(30)26(21)31/h4,7-12,17,20,23-25,27,33-35H,1-3,5-6,13-16H2,(H,32,36)/t20-,23-,24+,25+,27+/m0/s1 |
| InChIKey | SLAQJNVIPJPKPF-ZZNBOFLUSA-N |
| XLogP | 5.17 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |