C28H24N2O2 — CID 91403707
2-[2-(2-cyclopentyl-3H-benzimidazol-5-yl)ethynyl]-5-phenylmethoxybenzaldehyde (PubChem CID 91403707) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[2-(2-cyclopentyl-3H-benzimidazol-5-yl)ethynyl]-5-phenylmethoxybenzaldehyde.
| Compound Name | 2-[2-(2-cyclopentyl-3H-benzimidazol-5-yl)ethynyl]-5-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 91403707 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-[2-(2-cyclopentyl-3H-benzimidazol-5-yl)ethynyl]-5-phenylmethoxybenzaldehyde |
| SMILES | O=Cc1cc(OCc2ccccc2)ccc1C#Cc1ccc2nc(C3CCCC3)[nH]c2c1 |
| InChI | InChI=1S/C28H24N2O2/c31-18-24-17-25(32-19-21-6-2-1-3-7-21)14-13-22(24)12-10-20-11-15-26-27(16-20)30-28(29-26)23-8-4-5-9-23/h1-3,6-7,11,13-18,23H,4-5,8-9,19H2,(H,29,30) |
| InChIKey | ZJHKURYNDKYTTO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|