About 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate
3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate (PubChem CID 91404053) has the molecular formula C24H24O8
and a molecular weight of 440.45 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate |
| PubChem CID | 91404053 |
| Molecular Formula | C24H24O8 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CCOC(=O)C=Cc2ccc(OC(C)=O)c(OC(C)=O)c2)cc1OC |
| InChI | InChI=1S/C24H24O8/c1-16(25)31-21-11-8-19(15-23(21)32-17(2)26)9-12-24(27)30-13-5-6-18-7-10-20(28-3)22(14-18)29-4/h5-12,14-15H,13H2,1-4H3 |
| InChIKey | PUECXWNPTGYJMV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate?
The IUPAC name of 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate (CID 91404053) is 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate is COc1ccc(C=CCOC(=O)C=Cc2ccc(OC(C)=O)c(OC(C)=O)c2)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate?
The InChIKey is PUECXWNPTGYJMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24O8/c1-16(25)31-21-11-8-19(15-23(21)32-17(2)26)9-12-24(27)30-13-5-6-18-7-10-20(28-3)22(14-18)29-4/h5-12,14-15H,13H2,1-4H3.
What are the key properties of 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate?
3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate has a molecular weight of 440.45 g/mol, XLogP of 3.82, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)prop-2-enyl 3-(3,4-diacetyloxyphenyl)prop-2-enoate is sourced from PubChem (CID 91404053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).