C11H13N — CID 91404340
N-[(6-methylcycloocta-1,4,5,7-tetraen-1-yl)methyl]methanimine (PubChem CID 91404340) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is N-[(6-methylcycloocta-1,4,5,7-tetraen-1-yl)methyl]methanimine.
| Compound Name | N-[(6-methylcycloocta-1,4,5,7-tetraen-1-yl)methyl]methanimine |
|---|---|
| PubChem CID | 91404340 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | N-[(6-methylcycloocta-1,4,5,7-tetraen-1-yl)methyl]methanimine |
| SMILES | C=NCC1=CCC=C=C(C)C=C1 |
| InChI | InChI=1S/C11H13N/c1-10-5-3-4-6-11(8-7-10)9-12-2/h3,6-8H,2,4,9H2,1H3 |
| InChIKey | RAGZUBLGELMYAT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|