C21H26N2O — CID 91404917
4-[[(3,7-dimethyl-6-azatricyclo[6.5.0.02,5]trideca-1(8),6,10-trien-9-ylidene)amino]methyl]cyclohex-3-en-1-one (PubChem CID 91404917) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-[[(3,7-dimethyl-6-azatricyclo[6.5.0.02,5]trideca-1(8),6,10-trien-9-ylidene)amino]methyl]cyclohex-3-en-1-one.
| Compound Name | 4-[[(3,7-dimethyl-6-azatricyclo[6.5.0.02,5]trideca-1(8),6,10-trien-9-ylidene)amino]methyl]cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 91404917 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 4-[[(3,7-dimethyl-6-azatricyclo[6.5.0.02,5]trideca-1(8),6,10-trien-9-ylidene)amino]methyl]cyclohex-3-en-1-one |
| SMILES | CC1=NC2CC(C)C2C2=C1/C(=N/CC1=CCC(=O)CC1)C=CCC2 |
| InChI | InChI=1S/C21H26N2O/c1-13-11-19-20(13)17-5-3-4-6-18(21(17)14(2)23-19)22-12-15-7-9-16(24)10-8-15/h4,6-7,13,19-20H,3,5,8-12H2,1-2H3/b22-18+ |
| InChIKey | KCVSWPHPGINGKK-RELWKKBWSA-N |
| XLogP | 4.25 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|