C11H20N4O — CID 91405018
6-ethoxy-4-N-pentylpyrimidine-2,4-diamine (PubChem CID 91405018) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 6-ethoxy-4-N-pentylpyrimidine-2,4-diamine.
| Compound Name | 6-ethoxy-4-N-pentylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91405018 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 6-ethoxy-4-N-pentylpyrimidine-2,4-diamine |
| SMILES | CCCCCNc1cc(OCC)nc(N)n1 |
| InChI | InChI=1S/C11H20N4O/c1-3-5-6-7-13-9-8-10(16-4-2)15-11(12)14-9/h8H,3-7H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | YGSXATLBZKZUFZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|