About [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate
[3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate (PubChem CID 91405207) has the molecular formula C16H29N3O2
and a molecular weight of 295.43 g/mol. Its IUPAC name is [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate |
| PubChem CID | 91405207 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate |
| SMILES | Cn1cnc(CC(OC(=O)C(C)(C)C)C(N)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H29N3O2/c1-15(2,3)13(17)12(21-14(20)16(4,5)6)8-11-9-19(7)10-18-11/h9-10,12-13H,8,17H2,1-7H3 |
| InChIKey | HYMMNIUTGKCLRT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate?
The IUPAC name of [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate (CID 91405207) is [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate is Cn1cnc(CC(OC(=O)C(C)(C)C)C(N)C(C)(C)C)c1.
What is the InChIKey of [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate?
The InChIKey is HYMMNIUTGKCLRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N3O2/c1-15(2,3)13(17)12(21-14(20)16(4,5)6)8-11-9-19(7)10-18-11/h9-10,12-13H,8,17H2,1-7H3.
What are the key properties of [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate?
[3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate has a molecular weight of 295.43 g/mol, XLogP of 2.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-4,4-dimethyl-1-(1-methylimidazol-4-yl)pentan-2-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 91405207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).