C17H28O5 — CID 91405250
(2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl dec-8-enoate (PubChem CID 91405250) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl dec-8-enoate.
| Compound Name | (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl dec-8-enoate |
|---|---|
| PubChem CID | 91405250 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (2-acetyl-2-methyl-1,3-dioxolan-4-yl)methyl dec-8-enoate |
| SMILES | CC=CCCCCCCC(=O)OCC1COC(C)(C(C)=O)O1 |
| InChI | InChI=1S/C17H28O5/c1-4-5-6-7-8-9-10-11-16(19)20-12-15-13-21-17(3,22-15)14(2)18/h4-5,15H,6-13H2,1-3H3 |
| InChIKey | JHQWZDSPHLQSRB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|