C22H32N2O8S — CID 91405451
[[(3aR,6S,6aS)-6-heptoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]methylamino] N-(benzenesulfonyl)carbamate (PubChem CID 91405451) has the molecular formula C22H32N2O8S and a molecular weight of 484.57 g/mol. Its IUPAC name is [[(3aR,6S,6aS)-6-heptoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]methylamino] N-(benzenesulfonyl)carbamate.
| Compound Name | [[(3aR,6S,6aS)-6-heptoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]methylamino] N-(benzenesulfonyl)carbamate |
|---|---|
| PubChem CID | 91405451 |
| Molecular Formula | C22H32N2O8S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [[(3aR,6S,6aS)-6-heptoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]methylamino] N-(benzenesulfonyl)carbamate |
| SMILES | CCCCCCCO[C@H]1OC(=CNOC(=O)NS(=O)(=O)c2ccccc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C22H32N2O8S/c1-4-5-6-7-11-14-28-20-19-18(30-22(2,3)31-19)17(29-20)15-23-32-21(25)24-33(26,27)16-12-9-8-10-13-16/h8-10,12-13,15,18-20,23H,4-7,11,14H2,1-3H3,(H,24,25)/t18-,19-,20-/m0/s1 |
| InChIKey | YRBSTIYDLLRPBE-UFYCRDLUSA-N |
| XLogP | 3.31 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|