C23H22F6N4O — CID 91405620
N-(4-azido-1-phenylcyclohexyl)-2-[3,5-bis(trifluoromethyl)phenyl]propanamide (PubChem CID 91405620) has the molecular formula C23H22F6N4O and a molecular weight of 484.44 g/mol. Its IUPAC name is N-(4-azido-1-phenylcyclohexyl)-2-[3,5-bis(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-(4-azido-1-phenylcyclohexyl)-2-[3,5-bis(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 91405620 |
| Molecular Formula | C23H22F6N4O |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-(4-azido-1-phenylcyclohexyl)-2-[3,5-bis(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)NC1(c2ccccc2)CCC(N=[N+]=[N-])CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F6N4O/c1-14(15-11-17(22(24,25)26)13-18(12-15)23(27,28)29)20(34)31-21(16-5-3-2-4-6-16)9-7-19(8-10-21)32-33-30/h2-6,11-14,19H,7-10H2,1H3,(H,31,34) |
| InChIKey | NHGMTDWGMQVDLX-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|