About 5-ethoxy-2,4-dimethyl-1,3-benzothiazole
5-ethoxy-2,4-dimethyl-1,3-benzothiazole (PubChem CID 91405697) has the molecular formula C11H13NOS
and a molecular weight of 207.30 g/mol. Its IUPAC name is 5-ethoxy-2,4-dimethyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-ethoxy-2,4-dimethyl-1,3-benzothiazole |
| PubChem CID | 91405697 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 5-ethoxy-2,4-dimethyl-1,3-benzothiazole |
| SMILES | CCOc1ccc2sc(C)nc2c1C |
| InChI | InChI=1S/C11H13NOS/c1-4-13-9-5-6-10-11(7(9)2)12-8(3)14-10/h5-6H,4H2,1-3H3 |
| InChIKey | KBRQGOSHMXOCJP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethoxy-2,4-dimethyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-2,4-dimethyl-1,3-benzothiazole?
The IUPAC name of 5-ethoxy-2,4-dimethyl-1,3-benzothiazole (CID 91405697) is 5-ethoxy-2,4-dimethyl-1,3-benzothiazole.
What is the SMILES notation for 5-ethoxy-2,4-dimethyl-1,3-benzothiazole?
The canonical SMILES for 5-ethoxy-2,4-dimethyl-1,3-benzothiazole is CCOc1ccc2sc(C)nc2c1C.
What is the InChIKey of 5-ethoxy-2,4-dimethyl-1,3-benzothiazole?
The InChIKey is KBRQGOSHMXOCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS/c1-4-13-9-5-6-10-11(7(9)2)12-8(3)14-10/h5-6H,4H2,1-3H3.
What are the key properties of 5-ethoxy-2,4-dimethyl-1,3-benzothiazole?
5-ethoxy-2,4-dimethyl-1,3-benzothiazole has a molecular weight of 207.30 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-2,4-dimethyl-1,3-benzothiazole is sourced from PubChem (CID 91405697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).