C14H19N3 — CID 91406043
11-tert-butyl-7-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 91406043) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 11-tert-butyl-7-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 11-tert-butyl-7-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 91406043 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 11-tert-butyl-7-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | Cc1nc2cc(C(C)(C)C)nn2c2c1CCC2 |
| InChI | InChI=1S/C14H19N3/c1-9-10-6-5-7-11(10)17-13(15-9)8-12(16-17)14(2,3)4/h8H,5-7H2,1-4H3 |
| InChIKey | HGCBTNQTWBZOPW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |