C20H24Cl2O2 — CID 91406055
1-(9,9-dichloro-4-oxatricyclo[4.3.0.03,8]nonan-5-yl)-3-phenylhexan-1-one (PubChem CID 91406055) has the molecular formula C20H24Cl2O2 and a molecular weight of 367.32 g/mol. Its IUPAC name is 1-(9,9-dichloro-4-oxatricyclo[4.3.0.03,8]nonan-5-yl)-3-phenylhexan-1-one.
| Compound Name | 1-(9,9-dichloro-4-oxatricyclo[4.3.0.03,8]nonan-5-yl)-3-phenylhexan-1-one |
|---|---|
| PubChem CID | 91406055 |
| Molecular Formula | C20H24Cl2O2 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-(9,9-dichloro-4-oxatricyclo[4.3.0.03,8]nonan-5-yl)-3-phenylhexan-1-one |
| SMILES | CCCC(CC(=O)C1OC2CC3C1CC2C3(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C20H24Cl2O2/c1-2-6-13(12-7-4-3-5-8-12)9-17(23)19-14-10-16-18(24-19)11-15(14)20(16,21)22/h3-5,7-8,13-16,18-19H,2,6,9-11H2,1H3 |
| InChIKey | FUXDLHUZVDWQJP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|