C24H27FO3S — CID 91406543
4-[2-ethyl-4-(4-fluoro-3-methoxyphenyl)phenyl]-2,2,6,6-tetramethylthiane-3,5-dione (PubChem CID 91406543) has the molecular formula C24H27FO3S and a molecular weight of 414.54 g/mol. Its IUPAC name is 4-[2-ethyl-4-(4-fluoro-3-methoxyphenyl)phenyl]-2,2,6,6-tetramethylthiane-3,5-dione.
| Compound Name | 4-[2-ethyl-4-(4-fluoro-3-methoxyphenyl)phenyl]-2,2,6,6-tetramethylthiane-3,5-dione |
|---|---|
| PubChem CID | 91406543 |
| Molecular Formula | C24H27FO3S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-[2-ethyl-4-(4-fluoro-3-methoxyphenyl)phenyl]-2,2,6,6-tetramethylthiane-3,5-dione |
| SMILES | CCc1cc(-c2ccc(F)c(OC)c2)ccc1C1C(=O)C(C)(C)SC(C)(C)C1=O |
| InChI | InChI=1S/C24H27FO3S/c1-7-14-12-15(16-9-11-18(25)19(13-16)28-6)8-10-17(14)20-21(26)23(2,3)29-24(4,5)22(20)27/h8-13,20H,7H2,1-6H3 |
| InChIKey | HFYDXZUISWYFGI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|