About 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide
2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide (PubChem CID 91406755) has the molecular formula C21H13F6N3O2
and a molecular weight of 453.34 g/mol. Its IUPAC name is 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide |
| PubChem CID | 91406755 |
| Molecular Formula | C21H13F6N3O2 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cccc(C(=O)Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C21H13F6N3O2/c22-20(23,24)12-4-8-14(9-5-12)28-18(31)16-2-1-3-17(30-16)19(32)29-15-10-6-13(7-11-15)21(25,26)27/h1-11H,(H,28,31)(H,29,32) |
| InChIKey | JUBKMVDCYANHAG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide?
The IUPAC name of 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide (CID 91406755) is 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide.
What is the SMILES notation for 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide?
The canonical SMILES for 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide is O=C(Nc1ccc(C(F)(F)F)cc1)c1cccc(C(=O)Nc2ccc(C(F)(F)F)cc2)n1.
What is the InChIKey of 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide?
The InChIKey is JUBKMVDCYANHAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13F6N3O2/c22-20(23,24)12-4-8-14(9-5-12)28-18(31)16-2-1-3-17(30-16)19(32)29-15-10-6-13(7-11-15)21(25,26)27/h1-11H,(H,28,31)(H,29,32).
What are the key properties of 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide?
2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide has a molecular weight of 453.34 g/mol, XLogP of 5.62, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-N-bis[4-(trifluoromethyl)phenyl]pyridine-2,6-dicarboxamide is sourced from PubChem (CID 91406755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).