C30H36O2 — CID 91406926
1-(butoxymethyl)naphthalene;2-(butoxymethyl)naphthalene (PubChem CID 91406926) has the molecular formula C30H36O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 1-(butoxymethyl)naphthalene;2-(butoxymethyl)naphthalene.
| Compound Name | 1-(butoxymethyl)naphthalene;2-(butoxymethyl)naphthalene |
|---|---|
| PubChem CID | 91406926 |
| Molecular Formula | C30H36O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 1-(butoxymethyl)naphthalene;2-(butoxymethyl)naphthalene |
| SMILES | CCCCOCc1ccc2ccccc2c1.CCCCOCc1cccc2ccccc12 |
| InChI | InChI=1S/2C15H18O/c1-2-3-11-16-12-14-9-6-8-13-7-4-5-10-15(13)14;1-2-3-10-16-12-13-8-9-14-6-4-5-7-15(14)11-13/h4-10H,2-3,11-12H2,1H3;4-9,11H,2-3,10,12H2,1H3 |
| InChIKey | MFMNHICCQCUYMH-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|