C14H11NO — CID 91407166
11-oxa-15-azatricyclo[8.6.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaene (PubChem CID 91407166) has the molecular formula C14H11NO and a molecular weight of 209.25 g/mol. Its IUPAC name is 11-oxa-15-azatricyclo[8.6.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaene.
| Compound Name | 11-oxa-15-azatricyclo[8.6.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaene |
|---|---|
| PubChem CID | 91407166 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 11-oxa-15-azatricyclo[8.6.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaene |
| SMILES | C1=COC2C=Cc3ccccc3C2=C/N=C\1 |
| InChI | InChI=1S/C14H11NO/c1-2-5-12-11(4-1)6-7-14-13(12)10-15-8-3-9-16-14/h1-10,14H/b9-3?,13-10?,15-8- |
| InChIKey | URPCKNNHCWCZMJ-GKKNFJMUSA-N |
| XLogP | 3.04 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |