C22H23FN4O4 — CID 91407408
N-[(2S)-1-amino-1-oxopropan-2-yl]-3-[2-(4-fluorophenyl)ethenyl]-4-(3-hydroxypropoxy)-1H-indazole-5-carboxamide (PubChem CID 91407408) has the molecular formula C22H23FN4O4 and a molecular weight of 426.45 g/mol. Its IUPAC name is N-[(2S)-1-amino-1-oxopropan-2-yl]-3-[2-(4-fluorophenyl)ethenyl]-4-(3-hydroxypropoxy)-1H-indazole-5-carboxamide.
| Compound Name | N-[(2S)-1-amino-1-oxopropan-2-yl]-3-[2-(4-fluorophenyl)ethenyl]-4-(3-hydroxypropoxy)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91407408 |
| Molecular Formula | C22H23FN4O4 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[(2S)-1-amino-1-oxopropan-2-yl]-3-[2-(4-fluorophenyl)ethenyl]-4-(3-hydroxypropoxy)-1H-indazole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc2[nH]nc(C=Cc3ccc(F)cc3)c2c1OCCCO)C(N)=O |
| InChI | InChI=1S/C22H23FN4O4/c1-13(21(24)29)25-22(30)16-8-10-18-19(20(16)31-12-2-11-28)17(26-27-18)9-5-14-3-6-15(23)7-4-14/h3-10,13,28H,2,11-12H2,1H3,(H2,24,29)(H,25,30)(H,26,27)/t13-/m0/s1 |
| InChIKey | YZKDMWDRYIORNK-ZDUSSCGKSA-N |
| XLogP | 2.24 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|