C16H20N2O5S — CID 91407573
3-[butyl(methyl)amino]-4-(furan-3-yl)-5-sulfamoylbenzoic acid (PubChem CID 91407573) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 3-[butyl(methyl)amino]-4-(furan-3-yl)-5-sulfamoylbenzoic acid.
| Compound Name | 3-[butyl(methyl)amino]-4-(furan-3-yl)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 91407573 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 3-[butyl(methyl)amino]-4-(furan-3-yl)-5-sulfamoylbenzoic acid |
| SMILES | CCCCN(C)c1cc(C(=O)O)cc(S(N)(=O)=O)c1-c1ccoc1 |
| InChI | InChI=1S/C16H20N2O5S/c1-3-4-6-18(2)13-8-12(16(19)20)9-14(24(17,21)22)15(13)11-5-7-23-10-11/h5,7-10H,3-4,6H2,1-2H3,(H,19,20)(H2,17,21,22) |
| InChIKey | VJAVDRZIJOZKDF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |