C25H26O6S — CID 91407853
ethyl 2-[2-(2-methylphenyl)sulfonyloxyethoxy]-2,2-diphenylacetate (PubChem CID 91407853) has the molecular formula C25H26O6S and a molecular weight of 454.54 g/mol. Its IUPAC name is ethyl 2-[2-(2-methylphenyl)sulfonyloxyethoxy]-2,2-diphenylacetate.
| Compound Name | ethyl 2-[2-(2-methylphenyl)sulfonyloxyethoxy]-2,2-diphenylacetate |
|---|---|
| PubChem CID | 91407853 |
| Molecular Formula | C25H26O6S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | ethyl 2-[2-(2-methylphenyl)sulfonyloxyethoxy]-2,2-diphenylacetate |
| SMILES | CCOC(=O)C(OCCOS(=O)(=O)c1ccccc1C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26O6S/c1-3-29-24(26)25(21-13-6-4-7-14-21,22-15-8-5-9-16-22)30-18-19-31-32(27,28)23-17-11-10-12-20(23)2/h4-17H,3,18-19H2,1-2H3 |
| InChIKey | JAVOHBXFQYOUSN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|