C24H43NO3 — CID 91407881
1-(2-hydroxyethyl)-3-octadec-9-enylpyrrole-2,5-diol (PubChem CID 91407881) has the molecular formula C24H43NO3 and a molecular weight of 393.61 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-octadec-9-enylpyrrole-2,5-diol.
| Compound Name | 1-(2-hydroxyethyl)-3-octadec-9-enylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91407881 |
| Molecular Formula | C24H43NO3 |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 393.32 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-octadec-9-enylpyrrole-2,5-diol |
| SMILES | CCCCCCCCC=CCCCCCCCCc1cc(O)n(CCO)c1O |
| InChI | InChI=1S/C24H43NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-21-23(27)25(19-20-26)24(22)28/h9-10,21,26-28H,2-8,11-20H2,1H3 |
| InChIKey | ANTYYCUNMRSCRF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|