C15H15BrClFN6O — CID 91408699
4-bromo-2-chloro-6-[[(5-fluoro-4-piperazin-1-ylpyrimidin-2-yl)diazenyl]methyl]phenol (PubChem CID 91408699) has the molecular formula C15H15BrClFN6O and a molecular weight of 429.68 g/mol. Its IUPAC name is 4-bromo-2-chloro-6-[[(5-fluoro-4-piperazin-1-ylpyrimidin-2-yl)diazenyl]methyl]phenol.
| Compound Name | 4-bromo-2-chloro-6-[[(5-fluoro-4-piperazin-1-ylpyrimidin-2-yl)diazenyl]methyl]phenol |
|---|---|
| PubChem CID | 91408699 |
| Molecular Formula | C15H15BrClFN6O |
| Molecular Weight | 429.68 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 4-bromo-2-chloro-6-[[(5-fluoro-4-piperazin-1-ylpyrimidin-2-yl)diazenyl]methyl]phenol |
| SMILES | Oc1c(Cl)cc(Br)cc1C/N=N/c1ncc(F)c(N2CCNCC2)n1 |
| InChI | InChI=1S/C15H15BrClFN6O/c16-10-5-9(13(25)11(17)6-10)7-21-23-15-20-8-12(18)14(22-15)24-3-1-19-2-4-24/h5-6,8,19,25H,1-4,7H2/b23-21+ |
| InChIKey | JSVDEAUMWLTUOW-XTQSDGFTSA-N |
| XLogP | 3.43 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.68 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|