About N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide
N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide (PubChem CID 91408859) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide.
Molecular Properties
| Compound Name | N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide |
| PubChem CID | 91408859 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide |
| SMILES | O=C(NC(=O)C1CCC1)NC1C=CCC=C1 |
| InChI | InChI=1S/C12H16N2O2/c15-11(9-5-4-6-9)14-12(16)13-10-7-2-1-3-8-10/h2-3,7-10H,1,4-6H2,(H2,13,14,15,16) |
| InChIKey | CQEXKRYWFFZOLG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide?
The IUPAC name of N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide (CID 91408859) is N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide.
What is the SMILES notation for N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide?
The canonical SMILES for N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide is O=C(NC(=O)C1CCC1)NC1C=CCC=C1.
What is the InChIKey of N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide?
The InChIKey is CQEXKRYWFFZOLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c15-11(9-5-4-6-9)14-12(16)13-10-7-2-1-3-8-10/h2-3,7-10H,1,4-6H2,(H2,13,14,15,16).
What are the key properties of N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide?
N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide has a molecular weight of 220.27 g/mol, XLogP of 1.50, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-2,5-dien-1-ylcarbamoyl)cyclobutanecarboxamide is sourced from PubChem (CID 91408859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).