C27H27ClN2O3 — CID 91408948
3-[5-(6-chloroquinoxalin-2-yl)oxy-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione (PubChem CID 91408948) has the molecular formula C27H27ClN2O3 and a molecular weight of 462.98 g/mol. Its IUPAC name is 3-[5-(6-chloroquinoxalin-2-yl)oxy-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[5-(6-chloroquinoxalin-2-yl)oxy-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91408948 |
| Molecular Formula | C27H27ClN2O3 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 3-[5-(6-chloroquinoxalin-2-yl)oxy-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1C1C(=O)C2CCC(C)(C1=O)C2(C)C |
| InChI | InChI=1S/C27H27ClN2O3/c1-5-15-6-8-17(33-22-14-29-21-12-16(28)7-9-20(21)30-22)13-18(15)23-24(31)19-10-11-27(4,25(23)32)26(19,2)3/h6-9,12-14,19,23H,5,10-11H2,1-4H3 |
| InChIKey | AKOYFCCJFNYJCI-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|