C16H18ClN5OS — CID 91409097
5-chloro-N-piperidin-3-yl-4-pyrazolo[1,5-a]pyridin-3-yl-4,5-dihydro-1,3-thiazole-2-carboxamide (PubChem CID 91409097) has the molecular formula C16H18ClN5OS and a molecular weight of 363.87 g/mol. Its IUPAC name is 5-chloro-N-piperidin-3-yl-4-pyrazolo[1,5-a]pyridin-3-yl-4,5-dihydro-1,3-thiazole-2-carboxamide.
| Compound Name | 5-chloro-N-piperidin-3-yl-4-pyrazolo[1,5-a]pyridin-3-yl-4,5-dihydro-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 91409097 |
| Molecular Formula | C16H18ClN5OS |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 5-chloro-N-piperidin-3-yl-4-pyrazolo[1,5-a]pyridin-3-yl-4,5-dihydro-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NC1CCCNC1)C1=NC(c2cnn3ccccc23)C(Cl)S1 |
| InChI | InChI=1S/C16H18ClN5OS/c17-14-13(11-9-19-22-7-2-1-5-12(11)22)21-16(24-14)15(23)20-10-4-3-6-18-8-10/h1-2,5,7,9-10,13-14,18H,3-4,6,8H2,(H,20,23) |
| InChIKey | LXKVRYWJIILNRH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|