About 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile
3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile (PubChem CID 91409179) has the molecular formula C12H14ClN5O2
and a molecular weight of 295.73 g/mol. Its IUPAC name is 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile |
| PubChem CID | 91409179 |
| Molecular Formula | C12H14ClN5O2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)/N=N/C(C)(C#N)Cc1cc(O)n(Cl)c1O |
| InChI | InChI=1S/C12H14ClN5O2/c1-11(2,6-14)16-17-12(3,7-15)5-8-4-9(19)18(13)10(8)20/h4,19-20H,5H2,1-3H3/b17-16+ |
| InChIKey | RPHNZAPKDHQCRF-WUKNDPDISA-N |
| XLogP | 2.48 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile?
The IUPAC name of 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile (CID 91409179) is 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile.
What is the SMILES notation for 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile?
The canonical SMILES for 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile is CC(C)(C#N)/N=N/C(C)(C#N)Cc1cc(O)n(Cl)c1O.
What is the InChIKey of 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile?
The InChIKey is RPHNZAPKDHQCRF-WUKNDPDISA-N. The full InChI is InChI=1S/C12H14ClN5O2/c1-11(2,6-14)16-17-12(3,7-15)5-8-4-9(19)18(13)10(8)20/h4,19-20H,5H2,1-3H3/b17-16+.
What are the key properties of 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile?
3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile has a molecular weight of 295.73 g/mol, XLogP of 2.48, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-chloro-2,5-dihydroxypyrrol-3-yl)-2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile is sourced from PubChem (CID 91409179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).