C7H10OS — CID 91409186
1-methylsulfinylcyclohexa-1,4-diene (PubChem CID 91409186) has the molecular formula C7H10OS and a molecular weight of 142.22 g/mol. Its IUPAC name is 1-methylsulfinylcyclohexa-1,4-diene.
| Compound Name | 1-methylsulfinylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 91409186 |
| Molecular Formula | C7H10OS |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 1-methylsulfinylcyclohexa-1,4-diene |
| SMILES | CS(=O)C1=CCC=CC1 |
| InChI | InChI=1S/C7H10OS/c1-9(8)7-5-3-2-4-6-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | UHUUXDLLVJJQFM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|