About 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione
6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione (PubChem CID 91409282) has the molecular formula C17H18O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione.
Molecular Properties
| Compound Name | 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione |
| PubChem CID | 91409282 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione |
| SMILES | O=C1CCC(C2C=CCCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H18O2/c18-16-11-10-13(12-6-2-1-3-7-12)17(19)15-9-5-4-8-14(15)16/h2,4-6,8-9,12-13H,1,3,7,10-11H2 |
| InChIKey | OAKRFGLMKLMQLJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione?
The IUPAC name of 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione (CID 91409282) is 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione.
What is the SMILES notation for 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione?
The canonical SMILES for 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione is O=C1CCC(C2C=CCCC2)C(=O)c2ccccc21.
What is the InChIKey of 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione?
The InChIKey is OAKRFGLMKLMQLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2/c18-16-11-10-13(12-6-2-1-3-7-12)17(19)15-9-5-4-8-14(15)16/h2,4-6,8-9,12-13H,1,3,7,10-11H2.
What are the key properties of 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione?
6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione has a molecular weight of 254.33 g/mol, XLogP of 3.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohex-2-en-1-yl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione is sourced from PubChem (CID 91409282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).