C25H29BrN4O2 — CID 91409433
(1S,2R,3R,4R)-2-(4-bromophenyl)-3-[2-(1-ethyl-5-methylpyrazol-3-yl)ethyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 91409433) has the molecular formula C25H29BrN4O2 and a molecular weight of 497.44 g/mol. Its IUPAC name is (1S,2R,3R,4R)-2-(4-bromophenyl)-3-[2-(1-ethyl-5-methylpyrazol-3-yl)ethyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,2R,3R,4R)-2-(4-bromophenyl)-3-[2-(1-ethyl-5-methylpyrazol-3-yl)ethyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 91409433 |
| Molecular Formula | C25H29BrN4O2 |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | (1S,2R,3R,4R)-2-(4-bromophenyl)-3-[2-(1-ethyl-5-methylpyrazol-3-yl)ethyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CCn1nc(CC[C@@]2(C(N)=O)[C@@H]3C=C[C@@H](C34CC4)[C@@]2(C(N)=O)c2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C25H29BrN4O2/c1-3-30-15(2)14-18(29-30)10-11-24(21(27)31)19-8-9-20(23(19)12-13-23)25(24,22(28)32)16-4-6-17(26)7-5-16/h4-9,14,19-20H,3,10-13H2,1-2H3,(H2,27,31)(H2,28,32)/t19-,20+,24+,25-/m1/s1 |
| InChIKey | HAXANCZNZVRYAT-CYMHYUIHSA-N |
| XLogP | 3.40 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|