C24H23ClFN9O — CID 91409789
N-[3-chloro-4-(4-methyl-1H-pyrazol-5-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine (PubChem CID 91409789) has the molecular formula C24H23ClFN9O and a molecular weight of 507.96 g/mol. Its IUPAC name is N-[3-chloro-4-(4-methyl-1H-pyrazol-5-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine.
| Compound Name | N-[3-chloro-4-(4-methyl-1H-pyrazol-5-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 91409789 |
| Molecular Formula | C24H23ClFN9O |
| Molecular Weight | 507.96 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | N-[3-chloro-4-(4-methyl-1H-pyrazol-5-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
| SMILES | Cc1cn[nH]c1-c1ccc(Nc2ccc(C/N=N/c3ncc(F)c(N4CCOCC4)n3)nc2)cc1Cl |
| InChI | InChI=1S/C24H23ClFN9O/c1-15-11-29-33-22(15)19-5-4-16(10-20(19)25)31-18-3-2-17(27-12-18)13-30-34-24-28-14-21(26)23(32-24)35-6-8-36-9-7-35/h2-5,10-12,14,31H,6-9,13H2,1H3,(H,29,33)/b34-30+ |
| InChIKey | ZOWWWUYYMPHLRW-VBMGMRCRSA-N |
| XLogP | 5.23 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.96 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|