About 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine
6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine (PubChem CID 91409809) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine.
Analyze 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine?
The IUPAC name of 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine (CID 91409809) is 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine.
What is the SMILES notation for 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine?
The canonical SMILES for 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine is CC=CC1=C(C)CNCCC1.
What is the InChIKey of 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine?
The InChIKey is VFRFCFREVUDKPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-3-5-10-6-4-7-11-8-9(10)2/h3,5,11H,4,6-8H2,1-2H3.
What are the key properties of 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine?
6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine has a molecular weight of 151.25 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-prop-1-enyl-2,3,4,7-tetrahydro-1H-azepine is sourced from PubChem (CID 91409809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).