About (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate
(1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate (PubChem CID 91410258) has the molecular formula C18H21NO4S
and a molecular weight of 347.44 g/mol. Its IUPAC name is (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate.
Molecular Properties
| Compound Name | (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate |
| PubChem CID | 91410258 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2(C(N)=O)CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C18H21NO4S/c1-13-9-10-16(15-8-4-3-7-14(13)15)24(21,22)23-18(17(19)20)11-5-2-6-12-18/h3-4,7-10H,2,5-6,11-12H2,1H3,(H2,19,20) |
| InChIKey | YAVZRTZLTDKLEP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate?
The IUPAC name of (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate (CID 91410258) is (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate.
What is the SMILES notation for (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate?
The canonical SMILES for (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate is Cc1ccc(S(=O)(=O)OC2(C(N)=O)CCCCC2)c2ccccc12.
What is the InChIKey of (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate?
The InChIKey is YAVZRTZLTDKLEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO4S/c1-13-9-10-16(15-8-4-3-7-14(13)15)24(21,22)23-18(17(19)20)11-5-2-6-12-18/h3-4,7-10H,2,5-6,11-12H2,1H3,(H2,19,20).
What are the key properties of (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate?
(1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate has a molecular weight of 347.44 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylcyclohexyl) 4-methylnaphthalene-1-sulfonate is sourced from PubChem (CID 91410258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).