C17H15N3O3S — CID 91410825
2-(5-nitroindol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 91410825) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-(5-nitroindol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-(5-nitroindol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 91410825 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-(5-nitroindol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(-n2ccc3cc([N+](=O)[O-])ccc32)sc2c1CCCC2 |
| InChI | InChI=1S/C17H15N3O3S/c18-16(21)15-12-3-1-2-4-14(12)24-17(15)19-8-7-10-9-11(20(22)23)5-6-13(10)19/h5-9H,1-4H2,(H2,18,21) |
| InChIKey | NNIPRBFIMHINKH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|