C41H29N7 — CID 91410926
5-phenyl-10,15,20-tripyridin-2-yl-21,22,23,24-tetrahydroporphyrin (PubChem CID 91410926) has the molecular formula C41H29N7 and a molecular weight of 619.73 g/mol. Its IUPAC name is 5-phenyl-10,15,20-tripyridin-2-yl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5-phenyl-10,15,20-tripyridin-2-yl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91410926 |
| Molecular Formula | C41H29N7 |
| Molecular Weight | 619.73 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | 5-phenyl-10,15,20-tripyridin-2-yl-21,22,23,24-tetrahydroporphyrin |
| SMILES | c1ccc(C2=c3ccc([nH]3)=C(c3ccccn3)c3ccc([nH]3)C(c3ccccn3)=c3ccc([nH]3)=C(c3ccccn3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C41H29N7/c1-2-10-26(11-3-1)38-30-15-17-32(45-30)39(27-12-4-7-23-42-27)34-19-21-36(47-34)41(29-14-6-9-25-44-29)37-22-20-35(48-37)40(28-13-5-8-24-43-28)33-18-16-31(38)46-33/h1-25,45-48H |
| InChIKey | JZWQYKWZKYKFGF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.73 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |