2-(2,2-dimethylpentylamino)acetic acid

C9H19NO2 — CID 91411005

IUPAC2-(2,2-dimethylpentylamino)acetic acid
SMILESCCCC(C)(C)CNCC(=O)O
InChIInChI=1S/C9H19NO2/c1-4-5-9(2,3)7-10-6-8(11)12/h10H,4-7H2,1-3H3,(H,11,12)
InChIKeyJQOOISHEJXKYDZ-UHFFFAOYSA-N
MW173.26 g/mol
LogP1.49
Rot. Bonds6

About 2-(2,2-dimethylpentylamino)acetic acid

2-(2,2-dimethylpentylamino)acetic acid (PubChem CID 91411005) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-(2,2-dimethylpentylamino)acetic acid.

Molecular Properties

Compound Name2-(2,2-dimethylpentylamino)acetic acid
PubChem CID91411005
Molecular FormulaC9H19NO2
Molecular Weight173.26 g/mol
Exact Mass173.14
IUPAC Name2-(2,2-dimethylpentylamino)acetic acid
SMILESCCCC(C)(C)CNCC(=O)O
InChIInChI=1S/C9H19NO2/c1-4-5-9(2,3)7-10-6-8(11)12/h10H,4-7H2,1-3H3,(H,11,12)
InChIKeyJQOOISHEJXKYDZ-UHFFFAOYSA-N
XLogP1.49
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.26
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2,2-dimethylpentylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethylpentylamino)acetic acid?
The IUPAC name of 2-(2,2-dimethylpentylamino)acetic acid (CID 91411005) is 2-(2,2-dimethylpentylamino)acetic acid.
What is the SMILES notation for 2-(2,2-dimethylpentylamino)acetic acid?
The canonical SMILES for 2-(2,2-dimethylpentylamino)acetic acid is CCCC(C)(C)CNCC(=O)O.
What is the InChIKey of 2-(2,2-dimethylpentylamino)acetic acid?
The InChIKey is JQOOISHEJXKYDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-4-5-9(2,3)7-10-6-8(11)12/h10H,4-7H2,1-3H3,(H,11,12).
What are the key properties of 2-(2,2-dimethylpentylamino)acetic acid?
2-(2,2-dimethylpentylamino)acetic acid has a molecular weight of 173.26 g/mol, XLogP of 1.49, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpentylamino)acetic acid is sourced from PubChem (CID 91411005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).