C27H42F6O3 — CID 91411190
methyl 2,2-dimethylbutanoate;4-[3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 91411190) has the molecular formula C27H42F6O3 and a molecular weight of 528.62 g/mol. Its IUPAC name is methyl 2,2-dimethylbutanoate;4-[3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | methyl 2,2-dimethylbutanoate;4-[3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 91411190 |
| Molecular Formula | C27H42F6O3 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | methyl 2,2-dimethylbutanoate;4-[3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC(C)(C)OC(CC1CC2CC1C1C3CCC(C3)C21)(C(F)(F)F)C(F)(F)F.CCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C20H28F6O.C7H14O2/c1-17(2,3)27-18(19(21,22)23,20(24,25)26)9-13-7-12-8-14(13)16-11-5-4-10(6-11)15(12)16;1-5-7(2,3)6(8)9-4/h10-16H,4-9H2,1-3H3;5H2,1-4H3 |
| InChIKey | UNEMZYCFCFAZCM-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|