C25H28F3N3O6 — CID 91411248
(3S,6S,10aS)-N-(2-ethoxy-5-oxooxolan-3-yl)-5-oxo-6-[[2-(trifluoromethyl)benzoyl]amino]-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide (PubChem CID 91411248) has the molecular formula C25H28F3N3O6 and a molecular weight of 523.51 g/mol. Its IUPAC name is (3S,6S,10aS)-N-(2-ethoxy-5-oxooxolan-3-yl)-5-oxo-6-[[2-(trifluoromethyl)benzoyl]amino]-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide.
| Compound Name | (3S,6S,10aS)-N-(2-ethoxy-5-oxooxolan-3-yl)-5-oxo-6-[[2-(trifluoromethyl)benzoyl]amino]-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
|---|---|
| PubChem CID | 91411248 |
| Molecular Formula | C25H28F3N3O6 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | (3S,6S,10aS)-N-(2-ethoxy-5-oxooxolan-3-yl)-5-oxo-6-[[2-(trifluoromethyl)benzoyl]amino]-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
| SMILES | CCOC1OC(=O)CC1NC(=O)[C@@H]1CC[C@H]2CC=CC[C@H](NC(=O)c3ccccc3C(F)(F)F)C(=O)N21 |
| InChI | InChI=1S/C25H28F3N3O6/c1-2-36-24-18(13-20(32)37-24)30-22(34)19-12-11-14-7-3-6-10-17(23(35)31(14)19)29-21(33)15-8-4-5-9-16(15)25(26,27)28/h3-6,8-9,14,17-19,24H,2,7,10-13H2,1H3,(H,29,33)(H,30,34)/t14-,17+,18?,19+,24?/m1/s1 |
| InChIKey | ZRAFLBCFVFEPDA-PXWAIJSHSA-N |
| XLogP | 2.31 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|