C22H32N2O5S2 — CID 91411249
ethyl 2-[[1-[(8S)-8-(hydroperoxymethyl)-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate (PubChem CID 91411249) has the molecular formula C22H32N2O5S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is ethyl 2-[[1-[(8S)-8-(hydroperoxymethyl)-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate.
| Compound Name | ethyl 2-[[1-[(8S)-8-(hydroperoxymethyl)-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 91411249 |
| Molecular Formula | C22H32N2O5S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | ethyl 2-[[1-[(8S)-8-(hydroperoxymethyl)-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1CC2(C[C@H]1COO)SCCS2 |
| InChI | InChI=1S/C22H32N2O5S2/c1-3-28-21(26)19(10-9-17-7-5-4-6-8-17)23-16(2)20(25)24-15-22(30-11-12-31-22)13-18(24)14-29-27/h4-8,16,18-19,23,27H,3,9-15H2,1-2H3/t16?,18-,19?/m0/s1 |
| InChIKey | NUKGPPWSPQVCJW-AVAKVYKDSA-N |
| XLogP | 2.80 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|