C46H32N4O2 — CID 91411303
4-[15-(4-formylphenyl)-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde (PubChem CID 91411303) has the molecular formula C46H32N4O2 and a molecular weight of 672.79 g/mol. Its IUPAC name is 4-[15-(4-formylphenyl)-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde.
| Compound Name | 4-[15-(4-formylphenyl)-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 91411303 |
| Molecular Formula | C46H32N4O2 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | 4-[15-(4-formylphenyl)-10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde |
| SMILES | O=Cc1ccc(C2=c3ccc([nH]3)=C(c3ccccc3)c3ccc([nH]3)C(c3ccc(C=O)cc3)=c3ccc([nH]3)=C(c3ccccc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C46H32N4O2/c51-27-29-11-15-33(16-12-29)45-39-23-19-35(47-39)43(31-7-3-1-4-8-31)36-20-24-40(48-36)46(34-17-13-30(28-52)14-18-34)42-26-22-38(50-42)44(32-9-5-2-6-10-32)37-21-25-41(45)49-37/h1-28,47-50H |
| InChIKey | CIGFVTCDLWDPTA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|