C36H30N3O3+ — CID 91411811
1-[3-(furan-2-yl)-2-methoxyphenyl]-N-phenylmethanimine;3-phenyl-8-(1H-pyrrol-2-yl)-2H-1,3-benzoxazin-3-ium (PubChem CID 91411811) has the molecular formula C36H30N3O3+ and a molecular weight of 552.65 g/mol. Its IUPAC name is 1-[3-(furan-2-yl)-2-methoxyphenyl]-N-phenylmethanimine;3-phenyl-8-(1H-pyrrol-2-yl)-2H-1,3-benzoxazin-3-ium.
| Compound Name | 1-[3-(furan-2-yl)-2-methoxyphenyl]-N-phenylmethanimine;3-phenyl-8-(1H-pyrrol-2-yl)-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 91411811 |
| Molecular Formula | C36H30N3O3+ |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 1-[3-(furan-2-yl)-2-methoxyphenyl]-N-phenylmethanimine;3-phenyl-8-(1H-pyrrol-2-yl)-2H-1,3-benzoxazin-3-ium |
| SMILES | C1=[N+](c2ccccc2)COc2c1cccc2-c1ccc[nH]1.COc1c(/C=N/c2ccccc2)cccc1-c1ccco1 |
| InChI | InChI=1S/C18H15N2O.C18H15NO2/c1-2-7-15(8-3-1)20-12-14-6-4-9-16(18(14)21-13-20)17-10-5-11-19-17;1-20-18-14(13-19-15-8-3-2-4-9-15)7-5-10-16(18)17-11-6-12-21-17/h1-12,19H,13H2;2-13H,1H3/q+1;/b;19-13+ |
| InChIKey | TVMJDNBWEGEPET-RMKAVPEJSA-N |
| XLogP | 8.50 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|