About 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine
3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine (PubChem CID 91411877) has the molecular formula C16H18FNO2S
and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine.
Molecular Properties
| Compound Name | 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine |
| PubChem CID | 91411877 |
| Molecular Formula | C16H18FNO2S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine |
| SMILES | O=S(=O)(C1=CCC(C2CCNC2)=CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H18FNO2S/c17-14-2-1-3-16(10-14)21(19,20)15-6-4-12(5-7-15)13-8-9-18-11-13/h1-4,7,10,13,18H,5-6,8-9,11H2 |
| InChIKey | KRBHFJNSBNOWBN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine?
The IUPAC name of 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine (CID 91411877) is 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine.
What is the SMILES notation for 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine?
The canonical SMILES for 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine is O=S(=O)(C1=CCC(C2CCNC2)=CC1)c1cccc(F)c1.
What is the InChIKey of 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine?
The InChIKey is KRBHFJNSBNOWBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FNO2S/c17-14-2-1-3-16(10-14)21(19,20)15-6-4-12(5-7-15)13-8-9-18-11-13/h1-4,7,10,13,18H,5-6,8-9,11H2.
What are the key properties of 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine?
3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine has a molecular weight of 307.39 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-fluorophenyl)sulfonylcyclohexa-1,4-dien-1-yl]pyrrolidine is sourced from PubChem (CID 91411877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).