C11H12I2N2O5 — CID 91411905
1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl]-5-(2-iodoethenyl)pyrimidine-2,4-dione (PubChem CID 91411905) has the molecular formula C11H12I2N2O5 and a molecular weight of 506.03 g/mol. Its IUPAC name is 1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl]-5-(2-iodoethenyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl]-5-(2-iodoethenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91411905 |
| Molecular Formula | C11H12I2N2O5 |
| Molecular Weight | 506.03 g/mol |
| Exact Mass | 505.88 |
| IUPAC Name | 1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl]-5-(2-iodoethenyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2O[C@@H](CO)C(O)C2I)cc1C=CI |
| InChI | InChI=1S/C11H12I2N2O5/c12-2-1-5-3-15(11(19)14-9(5)18)10-7(13)8(17)6(4-16)20-10/h1-3,6-8,10,16-17H,4H2,(H,14,18,19)/t6-,7?,8?,10-/m0/s1 |
| InChIKey | LLXDMZAIHRZCFL-UNWHSVHXSA-N |
| XLogP | -0.00 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.03 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|