C28H32N2O3 — CID 91411944
N-(3-ethylpent-1-yn-3-yl)-4-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzamide (PubChem CID 91411944) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-(3-ethylpent-1-yn-3-yl)-4-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzamide.
| Compound Name | N-(3-ethylpent-1-yn-3-yl)-4-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzamide |
|---|---|
| PubChem CID | 91411944 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-(3-ethylpent-1-yn-3-yl)-4-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzamide |
| SMILES | C#CC(CC)(CC)NC(=O)c1ccc(C(=O)CC2=NC(C)(C)Cc3ccc(OC)cc32)cc1 |
| InChI | InChI=1S/C28H32N2O3/c1-7-28(8-2,9-3)30-26(32)20-12-10-19(11-13-20)25(31)17-24-23-16-22(33-6)15-14-21(23)18-27(4,5)29-24/h1,10-16H,8-9,17-18H2,2-6H3,(H,30,32) |
| InChIKey | KVOJHLOTJLLXPV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|