C14H18F3N — CID 91412002
4-(7,7,7-trifluoro-4,6-dimethylhept-2-en-2-yl)pyridine (PubChem CID 91412002) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is 4-(7,7,7-trifluoro-4,6-dimethylhept-2-en-2-yl)pyridine.
| Compound Name | 4-(7,7,7-trifluoro-4,6-dimethylhept-2-en-2-yl)pyridine |
|---|---|
| PubChem CID | 91412002 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-(7,7,7-trifluoro-4,6-dimethylhept-2-en-2-yl)pyridine |
| SMILES | CC(=CC(C)CC(C)C(F)(F)F)c1ccncc1 |
| InChI | InChI=1S/C14H18F3N/c1-10(9-12(3)14(15,16)17)8-11(2)13-4-6-18-7-5-13/h4-8,10,12H,9H2,1-3H3 |
| InChIKey | IZQSVTFJJNLKTD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |