About (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane
(1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane (PubChem CID 91412281) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane |
| PubChem CID | 91412281 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane |
| SMILES | CCC1CC(=C(C)C)C2[C@@H]1C2(C)C |
| InChI | InChI=1S/C13H22/c1-6-9-7-10(8(2)3)12-11(9)13(12,4)5/h9,11-12H,6-7H2,1-5H3/t9?,11-,12?/m1/s1 |
| InChIKey | UFZPXJBHNNNJDH-CKBZRRDASA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane?
The IUPAC name of (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane (CID 91412281) is (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane.
What is the SMILES notation for (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane?
The canonical SMILES for (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane is CCC1CC(=C(C)C)C2[C@@H]1C2(C)C.
What is the InChIKey of (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane?
The InChIKey is UFZPXJBHNNNJDH-CKBZRRDASA-N. The full InChI is InChI=1S/C13H22/c1-6-9-7-10(8(2)3)12-11(9)13(12,4)5/h9,11-12H,6-7H2,1-5H3/t9?,11-,12?/m1/s1.
What are the key properties of (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane?
(1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane has a molecular weight of 178.32 g/mol, XLogP of 4.02, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-ethyl-6,6-dimethyl-4-propan-2-ylidenebicyclo[3.1.0]hexane is sourced from PubChem (CID 91412281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).